C22H31Cl2F3N2O2 — CID 3039522
1-(1-ethynylcyclohexyl)oxy-3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propan-2-ol;dihydrochloride (PubChem CID 3039522) has the molecular formula C22H31Cl2F3N2O2 and a molecular weight of 483.40 g/mol. Its IUPAC name is 1-(1-ethynylcyclohexyl)oxy-3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propan-2-ol;dihydrochloride.
| Compound Name | 1-(1-ethynylcyclohexyl)oxy-3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propan-2-ol;dihydrochloride |
|---|---|
| PubChem CID | 3039522 |
| Molecular Formula | C22H31Cl2F3N2O2 |
| Molecular Weight | 483.40 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | 1-(1-ethynylcyclohexyl)oxy-3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propan-2-ol;dihydrochloride |
| SMILES | C#CC1(OCC(O)CN2CCN(c3cccc(C(F)(F)F)c3)CC2)CCCCC1.Cl.Cl |
| InChI | InChI=1S/C22H29F3N2O2.2ClH/c1-2-21(9-4-3-5-10-21)29-17-20(28)16-26-11-13-27(14-12-26)19-8-6-7-18(15-19)22(23,24)25;;/h1,6-8,15,20,28H,3-5,9-14,16-17H2;2*1H |
| InChIKey | SWSUAMFAZYRQFY-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.40 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|