C22H34Cl2N2O3 — CID 3039523
1-(1-ethynylcyclohexyl)oxy-3-[4-(2-methoxyphenyl)piperazin-1-yl]propan-2-ol;dihydrochloride (PubChem CID 3039523) has the molecular formula C22H34Cl2N2O3 and a molecular weight of 445.43 g/mol. Its IUPAC name is 1-(1-ethynylcyclohexyl)oxy-3-[4-(2-methoxyphenyl)piperazin-1-yl]propan-2-ol;dihydrochloride.
| Compound Name | 1-(1-ethynylcyclohexyl)oxy-3-[4-(2-methoxyphenyl)piperazin-1-yl]propan-2-ol;dihydrochloride |
|---|---|
| PubChem CID | 3039523 |
| Molecular Formula | C22H34Cl2N2O3 |
| Molecular Weight | 445.43 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | 1-(1-ethynylcyclohexyl)oxy-3-[4-(2-methoxyphenyl)piperazin-1-yl]propan-2-ol;dihydrochloride |
| SMILES | C#CC1(OCC(O)CN2CCN(c3ccccc3OC)CC2)CCCCC1.Cl.Cl |
| InChI | InChI=1S/C22H32N2O3.2ClH/c1-3-22(11-7-4-8-12-22)27-18-19(25)17-23-13-15-24(16-14-23)20-9-5-6-10-21(20)26-2;;/h1,5-6,9-10,19,25H,4,7-8,11-18H2,2H3;2*1H |
| InChIKey | PCPXLCJDRCIHIP-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.43 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|