C16H13ClIN3O — CID 3039558
5-(4-chlorophenyl)-N-(4-iodophenyl)-3,4-dihydropyrazole-2-carboxamide (PubChem CID 3039558) has the molecular formula C16H13ClIN3O and a molecular weight of 425.66 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N-(4-iodophenyl)-3,4-dihydropyrazole-2-carboxamide.
| Compound Name | 5-(4-chlorophenyl)-N-(4-iodophenyl)-3,4-dihydropyrazole-2-carboxamide |
|---|---|
| PubChem CID | 3039558 |
| Molecular Formula | C16H13ClIN3O |
| Molecular Weight | 425.66 g/mol |
| Exact Mass | 424.98 |
| IUPAC Name | 5-(4-chlorophenyl)-N-(4-iodophenyl)-3,4-dihydropyrazole-2-carboxamide |
| SMILES | O=C(Nc1ccc(I)cc1)N1CCC(c2ccc(Cl)cc2)=N1 |
| InChI | InChI=1S/C16H13ClIN3O/c17-12-3-1-11(2-4-12)15-9-10-21(20-15)16(22)19-14-7-5-13(18)6-8-14/h1-8H,9-10H2,(H,19,22) |
| InChIKey | RKPPSLIIWPOPLH-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.66 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|