C22H16Cl3N3O — CID 3042082
N,4,5-tris(4-chlorophenyl)-3,4-dihydropyrazole-2-carboxamide (PubChem CID 3042082) has the molecular formula C22H16Cl3N3O and a molecular weight of 444.75 g/mol. Its IUPAC name is N,4,5-tris(4-chlorophenyl)-3,4-dihydropyrazole-2-carboxamide.
| Compound Name | N,4,5-tris(4-chlorophenyl)-3,4-dihydropyrazole-2-carboxamide |
|---|---|
| PubChem CID | 3042082 |
| Molecular Formula | C22H16Cl3N3O |
| Molecular Weight | 444.75 g/mol |
| Exact Mass | 443.04 |
| IUPAC Name | N,4,5-tris(4-chlorophenyl)-3,4-dihydropyrazole-2-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1)N1CC(c2ccc(Cl)cc2)C(c2ccc(Cl)cc2)=N1 |
| InChI | InChI=1S/C22H16Cl3N3O/c23-16-5-1-14(2-6-16)20-13-28(22(29)26-19-11-9-18(25)10-12-19)27-21(20)15-3-7-17(24)8-4-15/h1-12,20H,13H2,(H,26,29) |
| InChIKey | ZIDQXZZLCKJURB-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.75 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |