C21H15N3O4S — CID 30397830
2-(4-cyanophenoxy)ethyl 2-([1]benzofuro[3,2-d]pyrimidin-4-ylsulfanyl)acetate (PubChem CID 30397830) has the molecular formula C21H15N3O4S and a molecular weight of 405.44 g/mol. Its IUPAC name is 2-(4-cyanophenoxy)ethyl 2-([1]benzofuro[3,2-d]pyrimidin-4-ylsulfanyl)acetate.
| Compound Name | 2-(4-cyanophenoxy)ethyl 2-([1]benzofuro[3,2-d]pyrimidin-4-ylsulfanyl)acetate |
|---|---|
| PubChem CID | 30397830 |
| Molecular Formula | C21H15N3O4S |
| Molecular Weight | 405.44 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | 2-(4-cyanophenoxy)ethyl 2-([1]benzofuro[3,2-d]pyrimidin-4-ylsulfanyl)acetate |
| SMILES | N#Cc1ccc(OCCOC(=O)CSc2ncnc3c2oc2ccccc23)cc1 |
| InChI | InChI=1S/C21H15N3O4S/c22-11-14-5-7-15(8-6-14)26-9-10-27-18(25)12-29-21-20-19(23-13-24-21)16-3-1-2-4-17(16)28-20/h1-8,13H,9-10,12H2 |
| InChIKey | DLFCHVWEPNPUQV-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 98.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.44 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|