C21H20BrN3O4S — CID 30398518
2-(2-bromo-4-ethylphenoxy)-N-[4-(pyridin-3-ylsulfamoyl)phenyl]acetamide (PubChem CID 30398518) has the molecular formula C21H20BrN3O4S and a molecular weight of 490.38 g/mol. Its IUPAC name is 2-(2-bromo-4-ethylphenoxy)-N-[4-(pyridin-3-ylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-(2-bromo-4-ethylphenoxy)-N-[4-(pyridin-3-ylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 30398518 |
| Molecular Formula | C21H20BrN3O4S |
| Molecular Weight | 490.38 g/mol |
| Exact Mass | 489.04 |
| IUPAC Name | 2-(2-bromo-4-ethylphenoxy)-N-[4-(pyridin-3-ylsulfamoyl)phenyl]acetamide |
| SMILES | CCc1ccc(OCC(=O)Nc2ccc(S(=O)(=O)Nc3cccnc3)cc2)c(Br)c1 |
| InChI | InChI=1S/C21H20BrN3O4S/c1-2-15-5-10-20(19(22)12-15)29-14-21(26)24-16-6-8-18(9-7-16)30(27,28)25-17-4-3-11-23-13-17/h3-13,25H,2,14H2,1H3,(H,24,26) |
| InChIKey | AZZWICJISXVEME-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.38 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |