C24H25BrN2O4S — CID 5173639
2-(2-bromo-4-ethylphenoxy)-N-[4-(2-phenylethylsulfamoyl)phenyl]acetamide (PubChem CID 5173639) has the molecular formula C24H25BrN2O4S and a molecular weight of 517.45 g/mol. Its IUPAC name is 2-(2-bromo-4-ethylphenoxy)-N-[4-(2-phenylethylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-(2-bromo-4-ethylphenoxy)-N-[4-(2-phenylethylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 5173639 |
| Molecular Formula | C24H25BrN2O4S |
| Molecular Weight | 517.45 g/mol |
| Exact Mass | 516.07 |
| IUPAC Name | 2-(2-bromo-4-ethylphenoxy)-N-[4-(2-phenylethylsulfamoyl)phenyl]acetamide |
| SMILES | CCc1ccc(OCC(=O)Nc2ccc(S(=O)(=O)NCCc3ccccc3)cc2)c(Br)c1 |
| InChI | InChI=1S/C24H25BrN2O4S/c1-2-18-8-13-23(22(25)16-18)31-17-24(28)27-20-9-11-21(12-10-20)32(29,30)26-15-14-19-6-4-3-5-7-19/h3-13,16,26H,2,14-15,17H2,1H3,(H,27,28) |
| InChIKey | ODISQSXTGMAWHR-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.45 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |