C14H11F3N2O4 — CID 30399814
1-[(2-methoxy-5-nitrophenyl)methyl]-5-(trifluoromethyl)pyridin-2-one (PubChem CID 30399814) has the molecular formula C14H11F3N2O4 and a molecular weight of 328.25 g/mol. Its IUPAC name is 1-[(2-methoxy-5-nitrophenyl)methyl]-5-(trifluoromethyl)pyridin-2-one.
| Compound Name | 1-[(2-methoxy-5-nitrophenyl)methyl]-5-(trifluoromethyl)pyridin-2-one |
|---|---|
| PubChem CID | 30399814 |
| Molecular Formula | C14H11F3N2O4 |
| Molecular Weight | 328.25 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | 1-[(2-methoxy-5-nitrophenyl)methyl]-5-(trifluoromethyl)pyridin-2-one |
| SMILES | COc1ccc([N+](=O)[O-])cc1Cn1cc(C(F)(F)F)ccc1=O |
| InChI | InChI=1S/C14H11F3N2O4/c1-23-12-4-3-11(19(21)22)6-9(12)7-18-8-10(14(15,16)17)2-5-13(18)20/h2-6,8H,7H2,1H3 |
| InChIKey | SXKFDADYZDTJMX-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 74.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.25 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|