C17H13F3N2O4 — CID 2323673
(E)-3-[2-(difluoromethoxy)-5-nitrophenyl]-N-[(4-fluorophenyl)methyl]prop-2-enamide (PubChem CID 2323673) has the molecular formula C17H13F3N2O4 and a molecular weight of 366.30 g/mol. Its IUPAC name is (E)-3-[2-(difluoromethoxy)-5-nitrophenyl]-N-[(4-fluorophenyl)methyl]prop-2-enamide.
| Compound Name | (E)-3-[2-(difluoromethoxy)-5-nitrophenyl]-N-[(4-fluorophenyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 2323673 |
| Molecular Formula | C17H13F3N2O4 |
| Molecular Weight | 366.30 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | (E)-3-[2-(difluoromethoxy)-5-nitrophenyl]-N-[(4-fluorophenyl)methyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1cc([N+](=O)[O-])ccc1OC(F)F)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C17H13F3N2O4/c18-13-4-1-11(2-5-13)10-21-16(23)8-3-12-9-14(22(24)25)6-7-15(12)26-17(19)20/h1-9,17H,10H2,(H,21,23)/b8-3+ |
| InChIKey | GXFMQYFBUXJVSG-FPYGCLRLSA-N |
| XLogP | 3.66 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.30 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|