C8H12OS2 — CID 3040117
2-(1,3-dithiolan-2-yl)cyclopentan-1-one (PubChem CID 3040117) has the molecular formula C8H12OS2 and a molecular weight of 188.32 g/mol. Its IUPAC name is 2-(1,3-dithiolan-2-yl)cyclopentan-1-one.
| Compound Name | 2-(1,3-dithiolan-2-yl)cyclopentan-1-one |
|---|---|
| PubChem CID | 3040117 |
| Molecular Formula | C8H12OS2 |
| Molecular Weight | 188.32 g/mol |
| Exact Mass | 188.03 |
| IUPAC Name | 2-(1,3-dithiolan-2-yl)cyclopentan-1-one |
| SMILES | O=C1CCCC1C1SCCS1 |
| InChI | InChI=1S/C8H12OS2/c9-7-3-1-2-6(7)8-10-4-5-11-8/h6,8H,1-5H2 |
| InChIKey | HOFFZVOTWVWHRK-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.32 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |