C9H14OS2 — CID 3040118
2-(1,3-dithiolan-2-yl)cyclohexan-1-one (PubChem CID 3040118) has the molecular formula C9H14OS2 and a molecular weight of 202.34 g/mol. Its IUPAC name is 2-(1,3-dithiolan-2-yl)cyclohexan-1-one.
| Compound Name | 2-(1,3-dithiolan-2-yl)cyclohexan-1-one |
|---|---|
| PubChem CID | 3040118 |
| Molecular Formula | C9H14OS2 |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.05 |
| IUPAC Name | 2-(1,3-dithiolan-2-yl)cyclohexan-1-one |
| SMILES | O=C1CCCCC1C1SCCS1 |
| InChI | InChI=1S/C9H14OS2/c10-8-4-2-1-3-7(8)9-11-5-6-12-9/h7,9H,1-6H2 |
| InChIKey | BVYQXYHTXJACIM-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |