C19H18ClN5O4S — CID 30406157
[2-[5-chloro-2-(1,2,4-triazol-1-yl)anilino]-2-oxoethyl] 4-(thiophene-3-carbonylamino)butanoate (PubChem CID 30406157) has the molecular formula C19H18ClN5O4S and a molecular weight of 447.90 g/mol. Its IUPAC name is [2-[5-chloro-2-(1,2,4-triazol-1-yl)anilino]-2-oxoethyl] 4-(thiophene-3-carbonylamino)butanoate.
| Compound Name | [2-[5-chloro-2-(1,2,4-triazol-1-yl)anilino]-2-oxoethyl] 4-(thiophene-3-carbonylamino)butanoate |
|---|---|
| PubChem CID | 30406157 |
| Molecular Formula | C19H18ClN5O4S |
| Molecular Weight | 447.90 g/mol |
| Exact Mass | 447.08 |
| IUPAC Name | [2-[5-chloro-2-(1,2,4-triazol-1-yl)anilino]-2-oxoethyl] 4-(thiophene-3-carbonylamino)butanoate |
| SMILES | O=C(COC(=O)CCCNC(=O)c1ccsc1)Nc1cc(Cl)ccc1-n1cncn1 |
| InChI | InChI=1S/C19H18ClN5O4S/c20-14-3-4-16(25-12-21-11-23-25)15(8-14)24-17(26)9-29-18(27)2-1-6-22-19(28)13-5-7-30-10-13/h3-5,7-8,10-12H,1-2,6,9H2,(H,22,28)(H,24,26) |
| InChIKey | ZLKLBJODGXNQQC-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 115.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.90 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|