C14H15ClN4O3 — CID 7796667
[2-[5-chloro-2-(1,2,4-triazol-1-yl)anilino]-2-oxoethyl] butanoate (PubChem CID 7796667) has the molecular formula C14H15ClN4O3 and a molecular weight of 322.75 g/mol. Its IUPAC name is [2-[5-chloro-2-(1,2,4-triazol-1-yl)anilino]-2-oxoethyl] butanoate.
| Compound Name | [2-[5-chloro-2-(1,2,4-triazol-1-yl)anilino]-2-oxoethyl] butanoate |
|---|---|
| PubChem CID | 7796667 |
| Molecular Formula | C14H15ClN4O3 |
| Molecular Weight | 322.75 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | [2-[5-chloro-2-(1,2,4-triazol-1-yl)anilino]-2-oxoethyl] butanoate |
| SMILES | CCCC(=O)OCC(=O)Nc1cc(Cl)ccc1-n1cncn1 |
| InChI | InChI=1S/C14H15ClN4O3/c1-2-3-14(21)22-7-13(20)18-11-6-10(15)4-5-12(11)19-9-16-8-17-19/h4-6,8-9H,2-3,7H2,1H3,(H,18,20) |
| InChIKey | JYRUUMDEILTIIA-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.75 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |