C17H23N3O2 — CID 3040684
(5R,7aR)-N,N-diethyl-3-oxo-2-phenyl-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c]imidazole-5-carboxamide (PubChem CID 3040684) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is (5R,7aR)-N,N-diethyl-3-oxo-2-phenyl-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c]imidazole-5-carboxamide.
| Compound Name | (5R,7aR)-N,N-diethyl-3-oxo-2-phenyl-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c]imidazole-5-carboxamide |
|---|---|
| PubChem CID | 3040684 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | (5R,7aR)-N,N-diethyl-3-oxo-2-phenyl-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c]imidazole-5-carboxamide |
| SMILES | CCN(CC)C(=O)[C@H]1CC[C@@H]2CN(c3ccccc3)C(=O)N21 |
| InChI | InChI=1S/C17H23N3O2/c1-3-18(4-2)16(21)15-11-10-14-12-19(17(22)20(14)15)13-8-6-5-7-9-13/h5-9,14-15H,3-4,10-12H2,1-2H3/t14-,15-/m1/s1 |
| InChIKey | PRXHNUONAYDIQT-HUUCEWRRSA-N |
| XLogP | 2.33 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |