C20H22ClFN2O3S2 — CID 3041892
1-(3-chloro-9-fluorobenzo[b][1]benzothiepin-6-yl)-4-methylpiperazine;methanesulfonic acid (PubChem CID 3041892) has the molecular formula C20H22ClFN2O3S2 and a molecular weight of 456.99 g/mol. Its IUPAC name is 1-(3-chloro-9-fluorobenzo[b][1]benzothiepin-6-yl)-4-methylpiperazine;methanesulfonic acid.
| Compound Name | 1-(3-chloro-9-fluorobenzo[b][1]benzothiepin-6-yl)-4-methylpiperazine;methanesulfonic acid |
|---|---|
| PubChem CID | 3041892 |
| Molecular Formula | C20H22ClFN2O3S2 |
| Molecular Weight | 456.99 g/mol |
| Exact Mass | 456.07 |
| IUPAC Name | 1-(3-chloro-9-fluorobenzo[b][1]benzothiepin-6-yl)-4-methylpiperazine;methanesulfonic acid |
| SMILES | CN1CCN(C2=Cc3cc(Cl)ccc3Sc3cc(F)ccc32)CC1.CS(=O)(=O)O |
| InChI | InChI=1S/C19H18ClFN2S.CH4O3S/c1-22-6-8-23(9-7-22)17-11-13-10-14(20)2-5-18(13)24-19-12-15(21)3-4-16(17)19;1-5(2,3)4/h2-5,10-12H,6-9H2,1H3;1H3,(H,2,3,4) |
| InChIKey | NCRDWAQSUUCYPO-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.99 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_ene_A(8)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|