C14H25N2O5PS — CID 3042710
5-[bis(2-methylpropoxy)phosphinothioyloxy]-4-methoxy-2-methylpyridazin-3-one (PubChem CID 3042710) has the molecular formula C14H25N2O5PS and a molecular weight of 364.40 g/mol. Its IUPAC name is 5-[bis(2-methylpropoxy)phosphinothioyloxy]-4-methoxy-2-methylpyridazin-3-one.
| Compound Name | 5-[bis(2-methylpropoxy)phosphinothioyloxy]-4-methoxy-2-methylpyridazin-3-one |
|---|---|
| PubChem CID | 3042710 |
| Molecular Formula | C14H25N2O5PS |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 5-[bis(2-methylpropoxy)phosphinothioyloxy]-4-methoxy-2-methylpyridazin-3-one |
| SMILES | COc1c(OP(=S)(OCC(C)C)OCC(C)C)cnn(C)c1=O |
| InChI | InChI=1S/C14H25N2O5PS/c1-10(2)8-19-22(23,20-9-11(3)4)21-12-7-15-16(5)14(17)13(12)18-6/h7,10-11H,8-9H2,1-6H3 |
| InChIKey | KHXBZLLVTWGRPU-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 71.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|