C14H24ClN5OS — CID 3043437
4-chloro-N-(3-methoxypropyl)-6-(4-methylpiperazin-1-yl)-5-methylsulfanylpyrimidin-2-amine (PubChem CID 3043437) has the molecular formula C14H24ClN5OS and a molecular weight of 345.90 g/mol. Its IUPAC name is 4-chloro-N-(3-methoxypropyl)-6-(4-methylpiperazin-1-yl)-5-methylsulfanylpyrimidin-2-amine.
| Compound Name | 4-chloro-N-(3-methoxypropyl)-6-(4-methylpiperazin-1-yl)-5-methylsulfanylpyrimidin-2-amine |
|---|---|
| PubChem CID | 3043437 |
| Molecular Formula | C14H24ClN5OS |
| Molecular Weight | 345.90 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 4-chloro-N-(3-methoxypropyl)-6-(4-methylpiperazin-1-yl)-5-methylsulfanylpyrimidin-2-amine |
| SMILES | COCCCNc1nc(Cl)c(SC)c(N2CCN(C)CC2)n1 |
| InChI | InChI=1S/C14H24ClN5OS/c1-19-6-8-20(9-7-19)13-11(22-3)12(15)17-14(18-13)16-5-4-10-21-2/h4-10H2,1-3H3,(H,16,17,18) |
| InChIKey | SGRKVDALNHWKBT-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.90 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|