C27H24N2O2 — CID 3044281
9-[4-(bicyclo[2.2.1]hepta-2,5-diene-2-carbonyl)piperazin-1-yl]tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaen-2-one (PubChem CID 3044281) has the molecular formula C27H24N2O2 and a molecular weight of 408.50 g/mol. Its IUPAC name is 9-[4-(bicyclo[2.2.1]hepta-2,5-diene-2-carbonyl)piperazin-1-yl]tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaen-2-one.
| Compound Name | 9-[4-(bicyclo[2.2.1]hepta-2,5-diene-2-carbonyl)piperazin-1-yl]tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaen-2-one |
|---|---|
| PubChem CID | 3044281 |
| Molecular Formula | C27H24N2O2 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 9-[4-(bicyclo[2.2.1]hepta-2,5-diene-2-carbonyl)piperazin-1-yl]tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaen-2-one |
| SMILES | O=C(C1=CC2C=CC1C2)N1CCN(c2cc3ccccc3c(=O)c3ccccc23)CC1 |
| InChI | InChI=1S/C27H24N2O2/c30-26-21-6-2-1-5-19(21)17-25(22-7-3-4-8-23(22)26)28-11-13-29(14-12-28)27(31)24-16-18-9-10-20(24)15-18/h1-10,16-18,20H,11-15H2 |
| InChIKey | JEZIQOZMMKRJTF-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|