C20H19ClN2O5 — CID 30444435
N-(4-chloro-2,5-dimethoxyphenyl)-3-(5-methyl-1,3-dioxoisoindol-2-yl)propanamide (PubChem CID 30444435) has the molecular formula C20H19ClN2O5 and a molecular weight of 402.83 g/mol. Its IUPAC name is N-(4-chloro-2,5-dimethoxyphenyl)-3-(5-methyl-1,3-dioxoisoindol-2-yl)propanamide.
| Compound Name | N-(4-chloro-2,5-dimethoxyphenyl)-3-(5-methyl-1,3-dioxoisoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 30444435 |
| Molecular Formula | C20H19ClN2O5 |
| Molecular Weight | 402.83 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | N-(4-chloro-2,5-dimethoxyphenyl)-3-(5-methyl-1,3-dioxoisoindol-2-yl)propanamide |
| SMILES | COc1cc(NC(=O)CCN2C(=O)c3ccc(C)cc3C2=O)c(OC)cc1Cl |
| InChI | InChI=1S/C20H19ClN2O5/c1-11-4-5-12-13(8-11)20(26)23(19(12)25)7-6-18(24)22-15-10-16(27-2)14(21)9-17(15)28-3/h4-5,8-10H,6-7H2,1-3H3,(H,22,24) |
| InChIKey | GBZNUFGBEAAMRB-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.83 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|