C20H18ClN3O5S — CID 19189124
N-[(4-chloro-2,5-dimethoxyphenyl)carbamothioyl]-3-(1,3-dioxoisoindol-2-yl)propanamide (PubChem CID 19189124) has the molecular formula C20H18ClN3O5S and a molecular weight of 447.90 g/mol. Its IUPAC name is N-[(4-chloro-2,5-dimethoxyphenyl)carbamothioyl]-3-(1,3-dioxoisoindol-2-yl)propanamide.
| Compound Name | N-[(4-chloro-2,5-dimethoxyphenyl)carbamothioyl]-3-(1,3-dioxoisoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 19189124 |
| Molecular Formula | C20H18ClN3O5S |
| Molecular Weight | 447.90 g/mol |
| Exact Mass | 447.07 |
| IUPAC Name | N-[(4-chloro-2,5-dimethoxyphenyl)carbamothioyl]-3-(1,3-dioxoisoindol-2-yl)propanamide |
| SMILES | COc1cc(NC(=S)NC(=O)CCN2C(=O)c3ccccc3C2=O)c(OC)cc1Cl |
| InChI | InChI=1S/C20H18ClN3O5S/c1-28-15-10-14(16(29-2)9-13(15)21)22-20(30)23-17(25)7-8-24-18(26)11-5-3-4-6-12(11)19(24)27/h3-6,9-10H,7-8H2,1-2H3,(H2,22,23,25,30) |
| InChIKey | AUMROQPDGHWUBW-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.90 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|