About cyclohexyl 4-amino-1-[(4-chlorophenyl)methyl]piperidine-4-carboxylate;oxalic acid
cyclohexyl 4-amino-1-[(4-chlorophenyl)methyl]piperidine-4-carboxylate;oxalic acid (PubChem CID 3044659) has the molecular formula C21H29ClN2O6
and a molecular weight of 440.92 g/mol. Its IUPAC name is cyclohexyl 4-amino-1-[(4-chlorophenyl)methyl]piperidine-4-carboxylate;oxalic acid.
Molecular Properties
| Compound Name | cyclohexyl 4-amino-1-[(4-chlorophenyl)methyl]piperidine-4-carboxylate;oxalic acid |
| PubChem CID | 3044659 |
| Molecular Formula | C21H29ClN2O6 |
| Molecular Weight | 440.92 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | cyclohexyl 4-amino-1-[(4-chlorophenyl)methyl]piperidine-4-carboxylate;oxalic acid |
| SMILES | NC1(C(=O)OC2CCCCC2)CCN(Cc2ccc(Cl)cc2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C19H27ClN2O2.C2H2O4/c20-16-8-6-15(7-9-16)14-22-12-10-19(21,11-13-22)18(23)24-17-4-2-1-3-5-17;3-1(4)2(5)6/h6-9,17H,1-5,10-14,21H2;(H,3,4)(H,5,6) |
| InChIKey | ZOTLHPCHTHZNCI-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 130.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.92 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze cyclohexyl 4-amino-1-[(4-chlorophenyl)methyl]piperidine-4-carboxylate;oxalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl 4-amino-1-[(4-chlorophenyl)methyl]piperidine-4-carboxylate;oxalic acid?
The IUPAC name of cyclohexyl 4-amino-1-[(4-chlorophenyl)methyl]piperidine-4-carboxylate;oxalic acid (CID 3044659) is cyclohexyl 4-amino-1-[(4-chlorophenyl)methyl]piperidine-4-carboxylate;oxalic acid.
What is the SMILES notation for cyclohexyl 4-amino-1-[(4-chlorophenyl)methyl]piperidine-4-carboxylate;oxalic acid?
The canonical SMILES for cyclohexyl 4-amino-1-[(4-chlorophenyl)methyl]piperidine-4-carboxylate;oxalic acid is NC1(C(=O)OC2CCCCC2)CCN(Cc2ccc(Cl)cc2)CC1.O=C(O)C(=O)O.
What is the InChIKey of cyclohexyl 4-amino-1-[(4-chlorophenyl)methyl]piperidine-4-carboxylate;oxalic acid?
The InChIKey is ZOTLHPCHTHZNCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27ClN2O2.C2H2O4/c20-16-8-6-15(7-9-16)14-22-12-10-19(21,11-13-22)18(23)24-17-4-2-1-3-5-17;3-1(4)2(5)6/h6-9,17H,1-5,10-14,21H2;(H,3,4)(H,5,6).
What are the key properties of cyclohexyl 4-amino-1-[(4-chlorophenyl)methyl]piperidine-4-carboxylate;oxalic acid?
cyclohexyl 4-amino-1-[(4-chlorophenyl)methyl]piperidine-4-carboxylate;oxalic acid has a molecular weight of 440.92 g/mol, XLogP of 2.66, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl 4-amino-1-[(4-chlorophenyl)methyl]piperidine-4-carboxylate;oxalic acid is sourced from PubChem (CID 3044659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).