C17H21N3O — CID 3044988
2-(4-phenylpiperazin-1-yl)-1-pyridin-3-ylethanol (PubChem CID 3044988) has the molecular formula C17H21N3O and a molecular weight of 283.38 g/mol. Its IUPAC name is 2-(4-phenylpiperazin-1-yl)-1-pyridin-3-ylethanol.
| Compound Name | 2-(4-phenylpiperazin-1-yl)-1-pyridin-3-ylethanol |
|---|---|
| PubChem CID | 3044988 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 2-(4-phenylpiperazin-1-yl)-1-pyridin-3-ylethanol |
| SMILES | OC(CN1CCN(c2ccccc2)CC1)c1cccnc1 |
| InChI | InChI=1S/C17H21N3O/c21-17(15-5-4-8-18-13-15)14-19-9-11-20(12-10-19)16-6-2-1-3-7-16/h1-8,13,17,21H,9-12,14H2 |
| InChIKey | SEBVEHLTCQRKHP-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |