C19H21Cl2NO5 — CID 3045045
2,2-bis(4-chlorophenoxy)-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]acetamide (PubChem CID 3045045) has the molecular formula C19H21Cl2NO5 and a molecular weight of 414.29 g/mol. Its IUPAC name is 2,2-bis(4-chlorophenoxy)-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]acetamide.
| Compound Name | 2,2-bis(4-chlorophenoxy)-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]acetamide |
|---|---|
| PubChem CID | 3045045 |
| Molecular Formula | C19H21Cl2NO5 |
| Molecular Weight | 414.29 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | 2,2-bis(4-chlorophenoxy)-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]acetamide |
| SMILES | CCC(CO)(CO)NC(=O)C(Oc1ccc(Cl)cc1)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H21Cl2NO5/c1-2-19(11-23,12-24)22-17(25)18(26-15-7-3-13(20)4-8-15)27-16-9-5-14(21)6-10-16/h3-10,18,23-24H,2,11-12H2,1H3,(H,22,25) |
| InChIKey | FNYHOWLAJNGHIY-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.29 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|