C27H33N5O3 — CID 30451457
1-ethyl-3-[(3S)-3-[4-(4-methoxyphenyl)piperazine-1-carbonyl]piperidin-1-yl]quinoxalin-2-one (PubChem CID 30451457) has the molecular formula C27H33N5O3 and a molecular weight of 475.59 g/mol. Its IUPAC name is 1-ethyl-3-[(3S)-3-[4-(4-methoxyphenyl)piperazine-1-carbonyl]piperidin-1-yl]quinoxalin-2-one.
| Compound Name | 1-ethyl-3-[(3S)-3-[4-(4-methoxyphenyl)piperazine-1-carbonyl]piperidin-1-yl]quinoxalin-2-one |
|---|---|
| PubChem CID | 30451457 |
| Molecular Formula | C27H33N5O3 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.26 |
| IUPAC Name | 1-ethyl-3-[(3S)-3-[4-(4-methoxyphenyl)piperazine-1-carbonyl]piperidin-1-yl]quinoxalin-2-one |
| SMILES | CCn1c(=O)c(N2CCC[C@H](C(=O)N3CCN(c4ccc(OC)cc4)CC3)C2)nc2ccccc21 |
| InChI | InChI=1S/C27H33N5O3/c1-3-32-24-9-5-4-8-23(24)28-25(27(32)34)31-14-6-7-20(19-31)26(33)30-17-15-29(16-18-30)21-10-12-22(35-2)13-11-21/h4-5,8-13,20H,3,6-7,14-19H2,1-2H3/t20-/m0/s1 |
| InChIKey | SUAGWWUOKNWTAX-FQEVSTJZSA-N |
| XLogP | 2.99 |
| TPSA | 70.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|