C28H37N5O2 — CID 124820810
[4-(4-methoxyphenyl)piperazin-1-yl]-[(3R)-1-[(1-propan-2-ylbenzimidazol-2-yl)methyl]piperidin-3-yl]methanone (PubChem CID 124820810) has the molecular formula C28H37N5O2 and a molecular weight of 475.64 g/mol. Its IUPAC name is [4-(4-methoxyphenyl)piperazin-1-yl]-[(3R)-1-[(1-propan-2-ylbenzimidazol-2-yl)methyl]piperidin-3-yl]methanone.
| Compound Name | [4-(4-methoxyphenyl)piperazin-1-yl]-[(3R)-1-[(1-propan-2-ylbenzimidazol-2-yl)methyl]piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 124820810 |
| Molecular Formula | C28H37N5O2 |
| Molecular Weight | 475.64 g/mol |
| Exact Mass | 475.29 |
| IUPAC Name | [4-(4-methoxyphenyl)piperazin-1-yl]-[(3R)-1-[(1-propan-2-ylbenzimidazol-2-yl)methyl]piperidin-3-yl]methanone |
| SMILES | COc1ccc(N2CCN(C(=O)[C@@H]3CCCN(Cc4nc5ccccc5n4C(C)C)C3)CC2)cc1 |
| InChI | InChI=1S/C28H37N5O2/c1-21(2)33-26-9-5-4-8-25(26)29-27(33)20-30-14-6-7-22(19-30)28(34)32-17-15-31(16-18-32)23-10-12-24(35-3)13-11-23/h4-5,8-13,21-22H,6-7,14-20H2,1-3H3/t22-/m1/s1 |
| InChIKey | HREGDWNIIVDENQ-JOCHJYFZSA-N |
| XLogP | 4.19 |
| TPSA | 53.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.64 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|