C29H39N5O — CID 124805083
[4-(3,4-dimethylphenyl)piperazin-1-yl]-[(3S)-1-[(1-propan-2-ylbenzimidazol-2-yl)methyl]piperidin-3-yl]methanone (PubChem CID 124805083) has the molecular formula C29H39N5O and a molecular weight of 473.67 g/mol. Its IUPAC name is [4-(3,4-dimethylphenyl)piperazin-1-yl]-[(3S)-1-[(1-propan-2-ylbenzimidazol-2-yl)methyl]piperidin-3-yl]methanone.
| Compound Name | [4-(3,4-dimethylphenyl)piperazin-1-yl]-[(3S)-1-[(1-propan-2-ylbenzimidazol-2-yl)methyl]piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 124805083 |
| Molecular Formula | C29H39N5O |
| Molecular Weight | 473.67 g/mol |
| Exact Mass | 473.32 |
| IUPAC Name | [4-(3,4-dimethylphenyl)piperazin-1-yl]-[(3S)-1-[(1-propan-2-ylbenzimidazol-2-yl)methyl]piperidin-3-yl]methanone |
| SMILES | Cc1ccc(N2CCN(C(=O)[C@H]3CCCN(Cc4nc5ccccc5n4C(C)C)C3)CC2)cc1C |
| InChI | InChI=1S/C29H39N5O/c1-21(2)34-27-10-6-5-9-26(27)30-28(34)20-31-13-7-8-24(19-31)29(35)33-16-14-32(15-17-33)25-12-11-22(3)23(4)18-25/h5-6,9-12,18,21,24H,7-8,13-17,19-20H2,1-4H3/t24-/m0/s1 |
| InChIKey | HVGWNACFHCAUSV-DEOSSOPVSA-N |
| XLogP | 4.79 |
| TPSA | 44.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.67 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|