C27H35N5O — CID 124915363
[4-(3,4-dimethylphenyl)piperazin-1-yl]-[(3S)-1-[(1-methylbenzimidazol-2-yl)methyl]piperidin-3-yl]methanone (PubChem CID 124915363) has the molecular formula C27H35N5O and a molecular weight of 445.61 g/mol. Its IUPAC name is [4-(3,4-dimethylphenyl)piperazin-1-yl]-[(3S)-1-[(1-methylbenzimidazol-2-yl)methyl]piperidin-3-yl]methanone.
| Compound Name | [4-(3,4-dimethylphenyl)piperazin-1-yl]-[(3S)-1-[(1-methylbenzimidazol-2-yl)methyl]piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 124915363 |
| Molecular Formula | C27H35N5O |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.28 |
| IUPAC Name | [4-(3,4-dimethylphenyl)piperazin-1-yl]-[(3S)-1-[(1-methylbenzimidazol-2-yl)methyl]piperidin-3-yl]methanone |
| SMILES | Cc1ccc(N2CCN(C(=O)[C@H]3CCCN(Cc4nc5ccccc5n4C)C3)CC2)cc1C |
| InChI | InChI=1S/C27H35N5O/c1-20-10-11-23(17-21(20)2)31-13-15-32(16-14-31)27(33)22-7-6-12-30(18-22)19-26-28-24-8-4-5-9-25(24)29(26)3/h4-5,8-11,17,22H,6-7,12-16,18-19H2,1-3H3/t22-/m0/s1 |
| InChIKey | CKMGVODCHXWJFC-QFIPXVFZSA-N |
| XLogP | 3.75 |
| TPSA | 44.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|