C32H36BrN5O — CID 124818490
[(3S)-1-[[1-(4-bromophenyl)benzimidazol-2-yl]methyl]piperidin-3-yl]-[4-(3,4-dimethylphenyl)piperazin-1-yl]methanone (PubChem CID 124818490) has the molecular formula C32H36BrN5O and a molecular weight of 586.58 g/mol. Its IUPAC name is [(3S)-1-[[1-(4-bromophenyl)benzimidazol-2-yl]methyl]piperidin-3-yl]-[4-(3,4-dimethylphenyl)piperazin-1-yl]methanone.
| Compound Name | [(3S)-1-[[1-(4-bromophenyl)benzimidazol-2-yl]methyl]piperidin-3-yl]-[4-(3,4-dimethylphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 124818490 |
| Molecular Formula | C32H36BrN5O |
| Molecular Weight | 586.58 g/mol |
| Exact Mass | 585.21 |
| IUPAC Name | [(3S)-1-[[1-(4-bromophenyl)benzimidazol-2-yl]methyl]piperidin-3-yl]-[4-(3,4-dimethylphenyl)piperazin-1-yl]methanone |
| SMILES | Cc1ccc(N2CCN(C(=O)[C@H]3CCCN(Cc4nc5ccccc5n4-c4ccc(Br)cc4)C3)CC2)cc1C |
| InChI | InChI=1S/C32H36BrN5O/c1-23-9-12-28(20-24(23)2)36-16-18-37(19-17-36)32(39)25-6-5-15-35(21-25)22-31-34-29-7-3-4-8-30(29)38(31)27-13-10-26(33)11-14-27/h3-4,7-14,20,25H,5-6,15-19,21-22H2,1-2H3/t25-/m0/s1 |
| InChIKey | BPFBNZZXKCDZEN-VWLOTQADSA-N |
| XLogP | 5.97 |
| TPSA | 44.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.58 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|