C33H38BrN5O — CID 124835719
[(3R)-1-[[1-(4-bromophenyl)benzimidazol-2-yl]methyl]piperidin-3-yl]-[4-(4-propan-2-ylphenyl)piperazin-1-yl]methanone (PubChem CID 124835719) has the molecular formula C33H38BrN5O and a molecular weight of 600.61 g/mol. Its IUPAC name is [(3R)-1-[[1-(4-bromophenyl)benzimidazol-2-yl]methyl]piperidin-3-yl]-[4-(4-propan-2-ylphenyl)piperazin-1-yl]methanone.
| Compound Name | [(3R)-1-[[1-(4-bromophenyl)benzimidazol-2-yl]methyl]piperidin-3-yl]-[4-(4-propan-2-ylphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 124835719 |
| Molecular Formula | C33H38BrN5O |
| Molecular Weight | 600.61 g/mol |
| Exact Mass | 599.23 |
| IUPAC Name | [(3R)-1-[[1-(4-bromophenyl)benzimidazol-2-yl]methyl]piperidin-3-yl]-[4-(4-propan-2-ylphenyl)piperazin-1-yl]methanone |
| SMILES | CC(C)c1ccc(N2CCN(C(=O)[C@@H]3CCCN(Cc4nc5ccccc5n4-c4ccc(Br)cc4)C3)CC2)cc1 |
| InChI | InChI=1S/C33H38BrN5O/c1-24(2)25-9-13-28(14-10-25)37-18-20-38(21-19-37)33(40)26-6-5-17-36(22-26)23-32-35-30-7-3-4-8-31(30)39(32)29-15-11-27(34)12-16-29/h3-4,7-16,24,26H,5-6,17-23H2,1-2H3/t26-/m1/s1 |
| InChIKey | GDSLOORRTAEJLM-AREMUKBSSA-N |
| XLogP | 6.47 |
| TPSA | 44.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.61 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|