C32H36BrN5O — CID 124835406
[(3S)-1-[[1-(4-bromophenyl)benzimidazol-2-yl]methyl]piperidin-3-yl]-[4-(4-ethylphenyl)piperazin-1-yl]methanone (PubChem CID 124835406) has the molecular formula C32H36BrN5O and a molecular weight of 586.58 g/mol. Its IUPAC name is [(3S)-1-[[1-(4-bromophenyl)benzimidazol-2-yl]methyl]piperidin-3-yl]-[4-(4-ethylphenyl)piperazin-1-yl]methanone.
| Compound Name | [(3S)-1-[[1-(4-bromophenyl)benzimidazol-2-yl]methyl]piperidin-3-yl]-[4-(4-ethylphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 124835406 |
| Molecular Formula | C32H36BrN5O |
| Molecular Weight | 586.58 g/mol |
| Exact Mass | 585.21 |
| IUPAC Name | [(3S)-1-[[1-(4-bromophenyl)benzimidazol-2-yl]methyl]piperidin-3-yl]-[4-(4-ethylphenyl)piperazin-1-yl]methanone |
| SMILES | CCc1ccc(N2CCN(C(=O)[C@H]3CCCN(Cc4nc5ccccc5n4-c4ccc(Br)cc4)C3)CC2)cc1 |
| InChI | InChI=1S/C32H36BrN5O/c1-2-24-9-13-27(14-10-24)36-18-20-37(21-19-36)32(39)25-6-5-17-35(22-25)23-31-34-29-7-3-4-8-30(29)38(31)28-15-11-26(33)12-16-28/h3-4,7-16,25H,2,5-6,17-23H2,1H3/t25-/m0/s1 |
| InChIKey | SKTAGOOLYNIFJI-VWLOTQADSA-N |
| XLogP | 5.91 |
| TPSA | 44.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.58 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|