C28H37N5O — CID 124809312
[(3S)-1-[(1-methylbenzimidazol-2-yl)methyl]piperidin-3-yl]-[4-(4-propan-2-ylphenyl)piperazin-1-yl]methanone (PubChem CID 124809312) has the molecular formula C28H37N5O and a molecular weight of 459.64 g/mol. Its IUPAC name is [(3S)-1-[(1-methylbenzimidazol-2-yl)methyl]piperidin-3-yl]-[4-(4-propan-2-ylphenyl)piperazin-1-yl]methanone.
| Compound Name | [(3S)-1-[(1-methylbenzimidazol-2-yl)methyl]piperidin-3-yl]-[4-(4-propan-2-ylphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 124809312 |
| Molecular Formula | C28H37N5O |
| Molecular Weight | 459.64 g/mol |
| Exact Mass | 459.30 |
| IUPAC Name | [(3S)-1-[(1-methylbenzimidazol-2-yl)methyl]piperidin-3-yl]-[4-(4-propan-2-ylphenyl)piperazin-1-yl]methanone |
| SMILES | CC(C)c1ccc(N2CCN(C(=O)[C@H]3CCCN(Cc4nc5ccccc5n4C)C3)CC2)cc1 |
| InChI | InChI=1S/C28H37N5O/c1-21(2)22-10-12-24(13-11-22)32-15-17-33(18-16-32)28(34)23-7-6-14-31(19-23)20-27-29-25-8-4-5-9-26(25)30(27)3/h4-5,8-13,21,23H,6-7,14-20H2,1-3H3/t23-/m0/s1 |
| InChIKey | MQKXBDCSRVHXFZ-QHCPKHFHSA-N |
| XLogP | 4.26 |
| TPSA | 44.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.64 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|