C10H10ClNO2 — CID 3046889
5-[(2-chlorophenyl)methyl]-1,3-oxazolidin-2-one (PubChem CID 3046889) has the molecular formula C10H10ClNO2 and a molecular weight of 211.65 g/mol. Its IUPAC name is 5-[(2-chlorophenyl)methyl]-1,3-oxazolidin-2-one.
| Compound Name | 5-[(2-chlorophenyl)methyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 3046889 |
| Molecular Formula | C10H10ClNO2 |
| Molecular Weight | 211.65 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | 5-[(2-chlorophenyl)methyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1NCC(Cc2ccccc2Cl)O1 |
| InChI | InChI=1S/C10H10ClNO2/c11-9-4-2-1-3-7(9)5-8-6-12-10(13)14-8/h1-4,8H,5-6H2,(H,12,13) |
| InChIKey | PCOMYIUSMUMECB-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.65 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |