C22H28ClN3O3 — CID 3046975
3-[1,4-bis(4-methoxyphenyl)pyrazol-3-yl]oxy-N,N-dimethylpropan-1-amine;hydrochloride (PubChem CID 3046975) has the molecular formula C22H28ClN3O3 and a molecular weight of 417.94 g/mol. Its IUPAC name is 3-[1,4-bis(4-methoxyphenyl)pyrazol-3-yl]oxy-N,N-dimethylpropan-1-amine;hydrochloride.
| Compound Name | 3-[1,4-bis(4-methoxyphenyl)pyrazol-3-yl]oxy-N,N-dimethylpropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 3046975 |
| Molecular Formula | C22H28ClN3O3 |
| Molecular Weight | 417.94 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | 3-[1,4-bis(4-methoxyphenyl)pyrazol-3-yl]oxy-N,N-dimethylpropan-1-amine;hydrochloride |
| SMILES | COc1ccc(-c2cn(-c3ccc(OC)cc3)nc2OCCCN(C)C)cc1.Cl |
| InChI | InChI=1S/C22H27N3O3.ClH/c1-24(2)14-5-15-28-22-21(17-6-10-19(26-3)11-7-17)16-25(23-22)18-8-12-20(27-4)13-9-18;/h6-13,16H,5,14-15H2,1-4H3;1H |
| InChIKey | VYJXSIXQYUWGAZ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 48.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.94 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|