C21H24ClN3O — CID 3046986
3-[1-(4-chlorophenyl)-4-(4-methylphenyl)pyrazol-3-yl]oxy-N,N-dimethylpropan-1-amine (PubChem CID 3046986) has the molecular formula C21H24ClN3O and a molecular weight of 369.90 g/mol. Its IUPAC name is 3-[1-(4-chlorophenyl)-4-(4-methylphenyl)pyrazol-3-yl]oxy-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[1-(4-chlorophenyl)-4-(4-methylphenyl)pyrazol-3-yl]oxy-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 3046986 |
| Molecular Formula | C21H24ClN3O |
| Molecular Weight | 369.90 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 3-[1-(4-chlorophenyl)-4-(4-methylphenyl)pyrazol-3-yl]oxy-N,N-dimethylpropan-1-amine |
| SMILES | Cc1ccc(-c2cn(-c3ccc(Cl)cc3)nc2OCCCN(C)C)cc1 |
| InChI | InChI=1S/C21H24ClN3O/c1-16-5-7-17(8-6-16)20-15-25(19-11-9-18(22)10-12-19)23-21(20)26-14-4-13-24(2)3/h5-12,15H,4,13-14H2,1-3H3 |
| InChIKey | OZBKKSXNSYJZKF-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.90 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|