C22H29ClN2O2 — CID 3047310
2-ethoxy-2,2-diphenyl-N-(2-pyrrolidin-1-ylethyl)acetamide;hydrochloride (PubChem CID 3047310) has the molecular formula C22H29ClN2O2 and a molecular weight of 388.94 g/mol. Its IUPAC name is 2-ethoxy-2,2-diphenyl-N-(2-pyrrolidin-1-ylethyl)acetamide;hydrochloride.
| Compound Name | 2-ethoxy-2,2-diphenyl-N-(2-pyrrolidin-1-ylethyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 3047310 |
| Molecular Formula | C22H29ClN2O2 |
| Molecular Weight | 388.94 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 2-ethoxy-2,2-diphenyl-N-(2-pyrrolidin-1-ylethyl)acetamide;hydrochloride |
| SMILES | CCOC(C(=O)NCCN1CCCC1)(c1ccccc1)c1ccccc1.Cl |
| InChI | InChI=1S/C22H28N2O2.ClH/c1-2-26-22(19-11-5-3-6-12-19,20-13-7-4-8-14-20)21(25)23-15-18-24-16-9-10-17-24;/h3-8,11-14H,2,9-10,15-18H2,1H3,(H,23,25);1H |
| InChIKey | KWJVKSBGWJEHBA-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.94 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |