C16H23NO7 — CID 3047888
(2R,3R)-2,3-dihydroxybutanedioic acid;3,4-dimethyl-2-phenylmorpholine (PubChem CID 3047888) has the molecular formula C16H23NO7 and a molecular weight of 341.36 g/mol. Its IUPAC name is (2R,3R)-2,3-dihydroxybutanedioic acid;3,4-dimethyl-2-phenylmorpholine.
| Compound Name | (2R,3R)-2,3-dihydroxybutanedioic acid;3,4-dimethyl-2-phenylmorpholine |
|---|---|
| PubChem CID | 3047888 |
| Molecular Formula | C16H23NO7 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | (2R,3R)-2,3-dihydroxybutanedioic acid;3,4-dimethyl-2-phenylmorpholine |
| SMILES | CC1C(c2ccccc2)OCCN1C.O=C(O)[C@H](O)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C12H17NO.C4H6O6/c1-10-12(14-9-8-13(10)2)11-6-4-3-5-7-11;5-1(3(7)8)2(6)4(9)10/h3-7,10,12H,8-9H2,1-2H3;1-2,5-6H,(H,7,8)(H,9,10)/t;1-,2-/m.1/s1 |
| InChIKey | VEPOHXYIFQMVHW-LREBCSMRSA-N |
| XLogP | -0.04 |
| TPSA | 127.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |