C48H62N4O6 — CID 3048548
oxalic acid;bis(N-phenyl-N-[2-(4-phenylpiperidin-1-yl)propyl]propanamide) (PubChem CID 3048548) has the molecular formula C48H62N4O6 and a molecular weight of 791.05 g/mol. Its IUPAC name is oxalic acid;bis(N-phenyl-N-[2-(4-phenylpiperidin-1-yl)propyl]propanamide).
| Compound Name | oxalic acid;bis(N-phenyl-N-[2-(4-phenylpiperidin-1-yl)propyl]propanamide) |
|---|---|
| PubChem CID | 3048548 |
| Molecular Formula | C48H62N4O6 |
| Molecular Weight | 791.05 g/mol |
| Exact Mass | 790.47 |
| IUPAC Name | oxalic acid;bis(N-phenyl-N-[2-(4-phenylpiperidin-1-yl)propyl]propanamide) |
| SMILES | CCC(=O)N(CC(C)N1CCC(c2ccccc2)CC1)c1ccccc1.CCC(=O)N(CC(C)N1CCC(c2ccccc2)CC1)c1ccccc1.O=C(O)C(=O)O |
| InChI | InChI=1S/2C23H30N2O.C2H2O4/c2*1-3-23(26)25(22-12-8-5-9-13-22)18-19(2)24-16-14-21(15-17-24)20-10-6-4-7-11-20;3-1(4)2(5)6/h2*4-13,19,21H,3,14-18H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | LWSXRFQDNPVXIU-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 121.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.05 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|