C21H26N2S — CID 3049322
2-benzyl-4-(4-methylpiperidin-1-yl)-2-thiophen-2-ylbutanenitrile (PubChem CID 3049322) has the molecular formula C21H26N2S and a molecular weight of 338.52 g/mol. Its IUPAC name is 2-benzyl-4-(4-methylpiperidin-1-yl)-2-thiophen-2-ylbutanenitrile.
| Compound Name | 2-benzyl-4-(4-methylpiperidin-1-yl)-2-thiophen-2-ylbutanenitrile |
|---|---|
| PubChem CID | 3049322 |
| Molecular Formula | C21H26N2S |
| Molecular Weight | 338.52 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | 2-benzyl-4-(4-methylpiperidin-1-yl)-2-thiophen-2-ylbutanenitrile |
| SMILES | CC1CCN(CCC(C#N)(Cc2ccccc2)c2cccs2)CC1 |
| InChI | InChI=1S/C21H26N2S/c1-18-9-12-23(13-10-18)14-11-21(17-22,20-8-5-15-24-20)16-19-6-3-2-4-7-19/h2-8,15,18H,9-14,16H2,1H3 |
| InChIKey | NFKOCTFNWDTGHS-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.52 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |