About 4-(2-aminopropyl)aniline
4-(2-aminopropyl)aniline (PubChem CID 3049430) has the molecular formula C9H14N2
and a molecular weight of 150.22 g/mol. Its IUPAC name is 4-(2-aminopropyl)aniline.
Molecular Properties
| Compound Name | 4-(2-aminopropyl)aniline |
| PubChem CID | 3049430 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 4-(2-aminopropyl)aniline |
| SMILES | CC(N)Cc1ccc(N)cc1 |
| InChI | InChI=1S/C9H14N2/c1-7(10)6-8-2-4-9(11)5-3-8/h2-5,7H,6,10-11H2,1H3 |
| InChIKey | UXAZIFYAGDKABZ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-aminopropyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-aminopropyl)aniline?
The IUPAC name of 4-(2-aminopropyl)aniline (CID 3049430) is 4-(2-aminopropyl)aniline.
What is the SMILES notation for 4-(2-aminopropyl)aniline?
The canonical SMILES for 4-(2-aminopropyl)aniline is CC(N)Cc1ccc(N)cc1.
What is the InChIKey of 4-(2-aminopropyl)aniline?
The InChIKey is UXAZIFYAGDKABZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2/c1-7(10)6-8-2-4-9(11)5-3-8/h2-5,7H,6,10-11H2,1H3.
What are the key properties of 4-(2-aminopropyl)aniline?
4-(2-aminopropyl)aniline has a molecular weight of 150.22 g/mol, XLogP of 1.16, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-aminopropyl)aniline is sourced from PubChem (CID 3049430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).