About 4-octylthiane 1-oxide
4-octylthiane 1-oxide (PubChem CID 3049462) has the molecular formula C13H26OS
and a molecular weight of 230.42 g/mol. Its IUPAC name is 4-octylthiane 1-oxide.
Molecular Properties
| Compound Name | 4-octylthiane 1-oxide |
| PubChem CID | 3049462 |
| Molecular Formula | C13H26OS |
| Molecular Weight | 230.42 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | 4-octylthiane 1-oxide |
| SMILES | CCCCCCCCC1CCS(=O)CC1 |
| InChI | InChI=1S/C13H26OS/c1-2-3-4-5-6-7-8-13-9-11-15(14)12-10-13/h13H,2-12H2,1H3 |
| InChIKey | XDNFRIZGSJGSOI-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.42 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-octylthiane 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-octylthiane 1-oxide?
The IUPAC name of 4-octylthiane 1-oxide (CID 3049462) is 4-octylthiane 1-oxide.
What is the SMILES notation for 4-octylthiane 1-oxide?
The canonical SMILES for 4-octylthiane 1-oxide is CCCCCCCCC1CCS(=O)CC1.
What is the InChIKey of 4-octylthiane 1-oxide?
The InChIKey is XDNFRIZGSJGSOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26OS/c1-2-3-4-5-6-7-8-13-9-11-15(14)12-10-13/h13H,2-12H2,1H3.
What are the key properties of 4-octylthiane 1-oxide?
4-octylthiane 1-oxide has a molecular weight of 230.42 g/mol, XLogP of 3.90, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-octylthiane 1-oxide is sourced from PubChem (CID 3049462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).