C8H16OS — CID 57484456
(1R,3R)-3-butylthiolane 1-oxide (PubChem CID 57484456) has the molecular formula C8H16OS and a molecular weight of 160.28 g/mol. Its IUPAC name is (1R,3R)-3-butylthiolane 1-oxide.
| Compound Name | (1R,3R)-3-butylthiolane 1-oxide |
|---|---|
| PubChem CID | 57484456 |
| Molecular Formula | C8H16OS |
| Molecular Weight | 160.28 g/mol |
| Exact Mass | 160.09 |
| IUPAC Name | (1R,3R)-3-butylthiolane 1-oxide |
| SMILES | CCCC[C@@H]1CC[S@@](=O)C1 |
| InChI | InChI=1S/C8H16OS/c1-2-3-4-8-5-6-10(9)7-8/h8H,2-7H2,1H3/t8-,10-/m1/s1 |
| InChIKey | QVVQIIIFHZDBDL-PSASIEDQSA-N |
| XLogP | 1.95 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.28 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |