C17H17FN2O3 — CID 3049894
methyl (4S,5R)-12-fluoro-6-methyl-2-oxo-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10,12,14-tetraene-4-carboxylate (PubChem CID 3049894) has the molecular formula C17H17FN2O3 and a molecular weight of 316.33 g/mol. Its IUPAC name is methyl (4S,5R)-12-fluoro-6-methyl-2-oxo-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10,12,14-tetraene-4-carboxylate.
| Compound Name | methyl (4S,5R)-12-fluoro-6-methyl-2-oxo-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10,12,14-tetraene-4-carboxylate |
|---|---|
| PubChem CID | 3049894 |
| Molecular Formula | C17H17FN2O3 |
| Molecular Weight | 316.33 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | methyl (4S,5R)-12-fluoro-6-methyl-2-oxo-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10,12,14-tetraene-4-carboxylate |
| SMILES | COC(=O)[C@H]1CC(=O)n2c3c(c4cc(F)ccc42)CCN(C)[C@@H]31 |
| InChI | InChI=1S/C17H17FN2O3/c1-19-6-5-10-11-7-9(18)3-4-13(11)20-14(21)8-12(17(22)23-2)15(19)16(10)20/h3-4,7,12,15H,5-6,8H2,1-2H3/t12-,15+/m0/s1 |
| InChIKey | BLNYUNLIJXXTSY-SWLSCSKDSA-N |
| XLogP | 2.14 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.33 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |