C11H13NOS — CID 3050895
1-(2-phenyl-1,3-thiazolidin-3-yl)ethanone (PubChem CID 3050895) has the molecular formula C11H13NOS and a molecular weight of 207.30 g/mol. Its IUPAC name is 1-(2-phenyl-1,3-thiazolidin-3-yl)ethanone.
| Compound Name | 1-(2-phenyl-1,3-thiazolidin-3-yl)ethanone |
|---|---|
| PubChem CID | 3050895 |
| Molecular Formula | C11H13NOS |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | 1-(2-phenyl-1,3-thiazolidin-3-yl)ethanone |
| SMILES | CC(=O)N1CCSC1c1ccccc1 |
| InChI | InChI=1S/C11H13NOS/c1-9(13)12-7-8-14-11(12)10-5-3-2-4-6-10/h2-6,11H,7-8H2,1H3 |
| InChIKey | YCXMWRGWKQQFNR-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |