C10H17NO3S3 — CID 3050988
(2S)-N-(2-hydroxysulfonothioyloxyethyl)-2-(3-methylthiophen-2-yl)propan-1-amine (PubChem CID 3050988) has the molecular formula C10H17NO3S3 and a molecular weight of 295.45 g/mol. Its IUPAC name is (2S)-N-(2-hydroxysulfonothioyloxyethyl)-2-(3-methylthiophen-2-yl)propan-1-amine.
| Compound Name | (2S)-N-(2-hydroxysulfonothioyloxyethyl)-2-(3-methylthiophen-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 3050988 |
| Molecular Formula | C10H17NO3S3 |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | (2S)-N-(2-hydroxysulfonothioyloxyethyl)-2-(3-methylthiophen-2-yl)propan-1-amine |
| SMILES | Cc1ccsc1[C@@H](C)CNCCOS(=O)(O)=S |
| InChI | InChI=1S/C10H17NO3S3/c1-8-3-6-16-10(8)9(2)7-11-4-5-14-17(12,13)15/h3,6,9,11H,4-5,7H2,1-2H3,(H,12,13,15)/t9-/m0/s1 |
| InChIKey | DQEOGSAYUAGDMU-VIFPVBQESA-N |
| XLogP | 1.90 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|