C18H22ClNO2 — CID 3051589
2-methyl-3-(3-phenylmethoxyphenyl)pyrrolidin-3-ol;hydrochloride (PubChem CID 3051589) has the molecular formula C18H22ClNO2 and a molecular weight of 319.83 g/mol. Its IUPAC name is 2-methyl-3-(3-phenylmethoxyphenyl)pyrrolidin-3-ol;hydrochloride.
| Compound Name | 2-methyl-3-(3-phenylmethoxyphenyl)pyrrolidin-3-ol;hydrochloride |
|---|---|
| PubChem CID | 3051589 |
| Molecular Formula | C18H22ClNO2 |
| Molecular Weight | 319.83 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | 2-methyl-3-(3-phenylmethoxyphenyl)pyrrolidin-3-ol;hydrochloride |
| SMILES | CC1NCCC1(O)c1cccc(OCc2ccccc2)c1.Cl |
| InChI | InChI=1S/C18H21NO2.ClH/c1-14-18(20,10-11-19-14)16-8-5-9-17(12-16)21-13-15-6-3-2-4-7-15;/h2-9,12,14,19-20H,10-11,13H2,1H3;1H |
| InChIKey | QPEUXHQMUXOAIA-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.83 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |