C27H20N4O — CID 3052765
View drug profile → pyrinoline[3-(dipyridin-2-ylmethylidene)cyclopenta-1,4-dien-1-yl]-dipyridin-2-ylmethanol (PubChem CID 3052765) has the molecular formula C27H20N4O and a molecular weight of 416.48 g/mol. Its IUPAC name is [3-(dipyridin-2-ylmethylidene)cyclopenta-1,4-dien-1-yl]-dipyridin-2-ylmethanol.
| Compound Name | [3-(dipyridin-2-ylmethylidene)cyclopenta-1,4-dien-1-yl]-dipyridin-2-ylmethanol |
|---|---|
| PubChem CID | 3052765 |
| Molecular Formula | C27H20N4O |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | [3-(dipyridin-2-ylmethylidene)cyclopenta-1,4-dien-1-yl]-dipyridin-2-ylmethanol |
| SMILES | OC(C1=CC(=C(c2ccccn2)c2ccccn2)C=C1)(c1ccccn1)c1ccccn1 |
| InChI | InChI=1S/C27H20N4O/c32-27(24-11-3-7-17-30-24,25-12-4-8-18-31-25)21-14-13-20(19-21)26(22-9-1-5-15-28-22)23-10-2-6-16-29-23/h1-19,32H |
| InChIKey | NCZXKYCNHGRFHE-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 71.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |