C8H7N3OS — CID 3053053
3-methoxy-5-thiophen-2-yl-1,2,4-triazine (PubChem CID 3053053) has the molecular formula C8H7N3OS and a molecular weight of 193.23 g/mol. Its IUPAC name is 3-methoxy-5-thiophen-2-yl-1,2,4-triazine.
| Compound Name | 3-methoxy-5-thiophen-2-yl-1,2,4-triazine |
|---|---|
| PubChem CID | 3053053 |
| Molecular Formula | C8H7N3OS |
| Molecular Weight | 193.23 g/mol |
| Exact Mass | 193.03 |
| IUPAC Name | 3-methoxy-5-thiophen-2-yl-1,2,4-triazine |
| SMILES | COc1nncc(-c2cccs2)n1 |
| InChI | InChI=1S/C8H7N3OS/c1-12-8-10-6(5-9-11-8)7-3-2-4-13-7/h2-5H,1H3 |
| InChIKey | LKQDEJAUWKNZLA-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.23 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |