C18H18ClFN2O3 — CID 30544669
2-(2-chloro-6-fluorophenyl)-N'-[2-(3,5-dimethylphenoxy)acetyl]acetohydrazide (PubChem CID 30544669) has the molecular formula C18H18ClFN2O3 and a molecular weight of 364.80 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-N'-[2-(3,5-dimethylphenoxy)acetyl]acetohydrazide.
| Compound Name | 2-(2-chloro-6-fluorophenyl)-N'-[2-(3,5-dimethylphenoxy)acetyl]acetohydrazide |
|---|---|
| PubChem CID | 30544669 |
| Molecular Formula | C18H18ClFN2O3 |
| Molecular Weight | 364.80 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-N'-[2-(3,5-dimethylphenoxy)acetyl]acetohydrazide |
| SMILES | Cc1cc(C)cc(OCC(=O)NNC(=O)Cc2c(F)cccc2Cl)c1 |
| InChI | InChI=1S/C18H18ClFN2O3/c1-11-6-12(2)8-13(7-11)25-10-18(24)22-21-17(23)9-14-15(19)4-3-5-16(14)20/h3-8H,9-10H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | GKGIEMHDTPHRDH-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.80 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|