C22H26N2O6 — CID 3054589
4-(N-[2-(N-acetyl-4-methoxyanilino)acetyl]-4-methoxyanilino)butanoic acid (PubChem CID 3054589) has the molecular formula C22H26N2O6 and a molecular weight of 414.46 g/mol. Its IUPAC name is 4-(N-[2-(N-acetyl-4-methoxyanilino)acetyl]-4-methoxyanilino)butanoic acid.
| Compound Name | 4-(N-[2-(N-acetyl-4-methoxyanilino)acetyl]-4-methoxyanilino)butanoic acid |
|---|---|
| PubChem CID | 3054589 |
| Molecular Formula | C22H26N2O6 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 4-(N-[2-(N-acetyl-4-methoxyanilino)acetyl]-4-methoxyanilino)butanoic acid |
| SMILES | COc1ccc(N(CC(=O)N(CCCC(=O)O)c2ccc(OC)cc2)C(C)=O)cc1 |
| InChI | InChI=1S/C22H26N2O6/c1-16(25)24(18-8-12-20(30-3)13-9-18)15-21(26)23(14-4-5-22(27)28)17-6-10-19(29-2)11-7-17/h6-13H,4-5,14-15H2,1-3H3,(H,27,28) |
| InChIKey | NYNAECCTFKFUIU-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |