C16H14BrNO3S — CID 30549045
(E)-N-(1,3-benzodioxol-5-ylmethyl)-3-(5-bromothiophen-2-yl)-N-methylprop-2-enamide (PubChem CID 30549045) has the molecular formula C16H14BrNO3S and a molecular weight of 380.26 g/mol. Its IUPAC name is (E)-N-(1,3-benzodioxol-5-ylmethyl)-3-(5-bromothiophen-2-yl)-N-methylprop-2-enamide.
| Compound Name | (E)-N-(1,3-benzodioxol-5-ylmethyl)-3-(5-bromothiophen-2-yl)-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 30549045 |
| Molecular Formula | C16H14BrNO3S |
| Molecular Weight | 380.26 g/mol |
| Exact Mass | 378.99 |
| IUPAC Name | (E)-N-(1,3-benzodioxol-5-ylmethyl)-3-(5-bromothiophen-2-yl)-N-methylprop-2-enamide |
| SMILES | CN(Cc1ccc2c(c1)OCO2)C(=O)/C=C/c1ccc(Br)s1 |
| InChI | InChI=1S/C16H14BrNO3S/c1-18(16(19)7-4-12-3-6-15(17)22-12)9-11-2-5-13-14(8-11)21-10-20-13/h2-8H,9-10H2,1H3/b7-4+ |
| InChIKey | BXPSIIVLFJITEV-QPJJXVBHSA-N |
| XLogP | 3.91 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.26 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|